Bisdemethoxycurcumin
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=(1E,6E)-1,7-Bis(4-hydroxyphenyl)-1,6-heptadiene-3,5-dione |Common Name=&&(E,E)-1,7-Bis(p-hydroxyphenyl)-1,6-heptadiene-3,5-dione&&(1E,6E)-...) |
|||
| Line 3: | Line 3: | ||
{{Metabolite | {{Metabolite | ||
|SysName=(1E,6E)-1,7-Bis(4-hydroxyphenyl)-1,6-heptadiene-3,5-dione | |SysName=(1E,6E)-1,7-Bis(4-hydroxyphenyl)-1,6-heptadiene-3,5-dione | ||
| − | |Common Name=&&(E,E)-1,7-Bis(p-hydroxyphenyl)-1,6-heptadiene-3,5-dione&&(1E,6E)-1,7-Bis(4-hydroxyphenyl)-1,6-heptadiene-3,5-dione | + | |Common Name=&&Bisdemethoxycurcumin&&(E,E)-1,7-Bis(p-hydroxyphenyl)-1,6-heptadiene-3,5-dione&&(1E,6E)-1,7-Bis(4-hydroxyphenyl)-1,6-heptadiene-3,5-dione&&Bisdesmethoxycurcumin&&Curcumin III&&Didemethoxycurcumin&& |
|CAS=33171-05-0 | |CAS=33171-05-0 | ||
|KNApSAcK= | |KNApSAcK= | ||
}} | }} | ||
Latest revision as of 13:55, 12 December 2009
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 33171-05-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | Bisdemethoxycurcumin.mol |
| Bisdemethoxycurcumin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (1E,6E)-1,7-Bis(4-hydroxyphenyl)-1,6-heptadiene-3,5-dione |
| Common Name |
|
| Symbol | |
| Formula | C19H16O4 |
| Exact Mass | 308.104859 |
| Average Mass | 308.32794 |
| SMILES | Oc(c1)ccc(C=CC(=O)CC(=O)C=Cc(c2)ccc(O)c2)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
