FL2F29NF0001
From Metabolomics.JP
(Difference between revisions)
| (4 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=6-Methoxy- [ 2",3":7,8 ] furanoflavanone |
| − | |Common Name=&&6-Methoxy-[2",3":7,8]furanoflavanone&& | + | |Common Name=&&6-Methoxy- [ 2",3":7,8 ] furanoflavanone&& |
|CAS=500342-66-5 | |CAS=500342-66-5 | ||
|KNApSAcK=C00014206 | |KNApSAcK=C00014206 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2F29 6,7,(3'),(5')-Hydroxyflavanone and O-methyl derivatives (1 pages) : FL2F29NF Furanoflavonoid (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 500342-66-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2F29NF0001.mol |
| 6-Methoxy- [ 2",3":7,8 ] furanoflavanone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 6-Methoxy- [ 2",3":7,8 ] furanoflavanone |
| Common Name |
|
| Symbol | |
| Formula | C18H14O4 |
| Exact Mass | 294.089208936 |
| Average Mass | 294.30136 |
| SMILES | c(c2OC)c(C(=O)4)c(OC(C4)c(c3)cccc3)c(c21)cco1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
