FL5FDDNM0002
From Metabolomics.JP
(Difference between revisions)
| (4 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=5-Hydroxy-2- (4-hydroxy-3-methoxyphenyl) -3,7-dimethoxy-6-methyl-4H-1-benzopyran-4-one |
| − | |Common Name=&&6-C-Methylquercetin 3,7,3'-trimethyl ether&&5-Hydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,7-dimethoxy-6-methyl-4H-1-benzopyran-4-one&& | + | |Common Name=&&6-C-Methylquercetin 3,7,3'-trimethyl ether&&5-Hydroxy-2- (4-hydroxy-3-methoxyphenyl) -3,7-dimethoxy-6-methyl-4H-1-benzopyran-4-one&& |
|CAS=99339-48-7 | |CAS=99339-48-7 | ||
|KNApSAcK=C00004899 | |KNApSAcK=C00004899 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FDD Quercetin O-methyl derivatives (4'-hydroxy-3'-methoxy, without FL5FAD, FL5FBD, FL5FCD) (21 pages) : FL5FDDNM C-Methyl or C2/C3 substituted (4 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 99339-48-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FDDNM0002.mol |
| 6-C-Methylquercetin 3,7,3'-trimethyl ether | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5-Hydroxy-2- (4-hydroxy-3-methoxyphenyl) -3,7-dimethoxy-6-methyl-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C19H18O7 |
| Exact Mass | 358.10525293 |
| Average Mass | 358.34202000000005 |
| SMILES | c(c3C)(OC)cc(O1)c(c3O)C(C(=C1c(c2)cc(OC)c(O)c2)OC) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
