FL5FFANS0012
From Metabolomics.JP
(Difference between revisions)
| (6 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName=5-Hydroxy-2- (4-hydroxyphenyl) -3,7,8-trimethoxy-4H-1-benzopyran-4-one |
| − | |Common Name=&& | + | |Common Name=&&5,4'-Dihydroxy-3,7,8-trimethoxyflavone&&Herbacetin 3,7,8-trimethyl ether&&5-Hydroxy-2- (4-hydroxyphenyl) -3,7,8-trimethoxy-4H-1-benzopyran-4-one&& |
|CAS=6586-29-4 | |CAS=6586-29-4 | ||
|KNApSAcK=C00004619 | |KNApSAcK=C00004619 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FFA Herbacetin and O-methyl derivatives (70 pages) : FL5FFANS Simple substitution (24 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 6586-29-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FFANS0012.mol |
| 5,4'-Dihydroxy-3,7,8-trimethoxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5-Hydroxy-2- (4-hydroxyphenyl) -3,7,8-trimethoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C18H16O7 |
| Exact Mass | 344.089602866 |
| Average Mass | 344.31543999999997 |
| SMILES | c(c1OC)(OC)cc(c(C2=O)c(OC(c(c3)ccc(O)c3)=C2OC)1)O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
