FL7AAANS0001
From Metabolomics.JP
(Difference between revisions)
| (5 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=3,5,7-Trihydroxy-2- (4-hydroxyphenyl) -1-benzopyrylium |
| − | |Common Name=&&Pelargonidin&& | + | |Common Name=&&Pelargonidin&&3,4',5,7-Tetrahydroxyflavylium&& |
|CAS=134-04-3 | |CAS=134-04-3 | ||
|KNApSAcK=C00007232 | |KNApSAcK=C00007232 | ||
}} | }} | ||
Latest revision as of 16:33, 5 January 2010
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL7 Anthocyani(di)n : FL7A Anthocyani(di)n : FL7AAA Pelargonidin (96 pages) : FL7AAANS Anthocyanidin (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 134-04-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL7AAANS0001.mol |
| Pelargonidin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,7-Trihydroxy-2- (4-hydroxyphenyl) -1-benzopyrylium |
| Common Name |
|
| Symbol | |
| Formula | C15H11O5 |
| Exact Mass | 271.060648462 |
| Average Mass | 271.24484 |
| SMILES | Oc(c3)ccc(c3)c([o+1]1)c(O)cc(c(O)2)c(cc(O)c2)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
