FLNACENS0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |Sysname=5,3'-Dihydroxy-7,4'-dimethoxy-4-phenylcoumarin |
|Common Name=&&5,3'-Dihydroxy-7,4'-dimethoxy-4-phenylcoumarin&& | |Common Name=&&5,3'-Dihydroxy-7,4'-dimethoxy-4-phenylcoumarin&& | ||
|CAS=117783-75-2 | |CAS=117783-75-2 | ||
|KNApSAcK=C00010245 | |KNApSAcK=C00010245 | ||
}} | }} | ||
Revision as of 09:00, 12 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 117783-75-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLNACENS0001.mol |
| 5,3'-Dihydroxy-7,4'-dimethoxy-4-phenylcoumarin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | |
| Common Name |
|
| Symbol | |
| Formula | C17H14O6 |
| Exact Mass | 314.07903818 |
| Average Mass | 314.28945999999996 |
| SMILES | COc(c3)cc(O2)c(c(O)3)C(=CC(=O)2)c(c1)cc(O)c(OC)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
