LBF18108HP03
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA8077 | |LipidBank=DFA8077 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA8077 |
LipidMaps | LMFA01040058 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18108HP03.mol |
![]() | |
Structural Information | |
Systematic Name | Methyl-9,12,13,15-Bisepidioxy-16-Hydroperoxy-10-Octadecenoate |
Common Name | |
Symbol | |
Formula | C19H32O8 |
Exact Mass | 388.20971799999995 |
Average Mass | 388.45258 |
SMILES | C(O1)(C(CC)OO)CC(C(C=2)OOC(CCCCCCCC(=O)OC)C2)O1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | GC-EI-MS(after reduction(PH3P) and TMS-derivatization)<<8085>>: m/e=313[M-131]; 131[SMTO=CHCH2CH3]; GC-EI-MS(after reduction, hydrogenation, and TMS-derivatization)<<8085>>: m/e=389[SMTO=CH(CH2)2CH(OTMS)(CH2)7COOCH3]; 299[389-HOTMS]; 259[SMTO=CH(CH2)7COOCH3] |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H-NMR<<8085>>: C9, 12, 13, 15: 4.45ppm; C10, 11: 5.68ppm; C14: 2.1-2.7ppm; C16: 4.08 ppm; C17: 1.6ppm; OOH: 8.45ppm |
Chromatograms |