LBF18203EO01
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA8071 | |LipidBank=DFA8071 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA8071 |
LipidMaps | LMFA01070012 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18203EO01.mol |
![]() | |
Structural Information | |
Systematic Name | Methyl-9,10-Epoxy-12,15-Octadecadienoate |
Common Name | |
Symbol | |
Formula | C19H32O3 |
Exact Mass | 308.23514489 |
Average Mass | 308.45558 |
SMILES | C(C(CC=CCC=CCC)1)(CCCCCCCC(=O)OC)O1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | Cis unsaturation: 3002cm-1<<8081>> |
NMR Spectra | GC-EI-MS<<8084>>: m/e=308[M]; 277[M-OCH3]; 199[CH-(O)-CH(CH2)7COOCH3]; 171[199-28]; 151[M-(CH2)7COOCH3]; 123[151-28]; GC-EI-MS(after hydrogenation)<<8084>>: m/e=281[M-OCH3]; 199[CH-(O)-CH(CH2)7COOCH3]; 171[199-28]; 155[M-(CH2)7COOCH3]127[155-28] |
Chromatograms |