LBF20406AM03
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7019 | |LipidBank=XPR7019 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR7019 |
LipidMaps | - |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM03.mol |
![]() | |
Structural Information | |
Systematic Name | N-arachidonoyl-L-serine |
Common Name | |
Symbol | |
Formula | C23H37NO4 |
Exact Mass | 391.27225867699997 |
Average Mass | 391.54422 |
SMILES | [C@@H](CO)(C(O)=O)NC(CCCC=CCC=CCC=CCC=CCCCCC)=O |
Physicochemical Information | |
Melting Point | colorless oil <<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | dX425= +8.9° <<7001>> |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CD3OD) d5.33-5.40 (m, 8H), 4.50 (t, J=4.8 Hz, 1H), 3.78-3.90 (m, 2H), 2.80-2.86 (m, 6H), 2.29 (t, J=6.6Hz, 2H), 2.04-2.18 (m, 4H), 1.64-1.72 (m, 2H), 1.29-1.39 (m, 6H), 0.90 (t, J=7.2Hz, 3H) <<7001>> |
Chromatograms |