BMMCBZ2Pk002
From Metabolomics.JP
(Difference between revisions)
Line 2: | Line 2: | ||
|SysName=(R)-3-(4-Hydroxy-phenyl)-lactic acid | |SysName=(R)-3-(4-Hydroxy-phenyl)-lactic acid | ||
|Common Name=&&(R)-3-(4-Hydroxyphenyl)lactate&& | |Common Name=&&(R)-3-(4-Hydroxyphenyl)lactate&& | ||
− | |CAS= | + | |CAS=89919-57-3 |
|KEGG=C03964 | |KEGG=C03964 | ||
}} | }} |
Revision as of 09:00, 14 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 89919-57-3 |
KEGG | C03964 |
KNApSAcK | |
CDX file | |
MOL file | BMMCBZ2Pk002.mol |
(R)-3-(4-Hydroxyphenyl)lactate | |
---|---|
![]() | |
Structural Information | |
Systematic Name | (R)-3-(4-Hydroxy-phenyl)-lactic acid |
Common Name |
|
Symbol | |
Formula | C9H10O4 |
Exact Mass | 182.0579 |
Average Mass | 182.1733 |
SMILES | Oc(c1)ccc(c1)C[C@@H](O)C(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways