BMMCPYUR0019
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 63-39-8 |
| KEGG | C00075 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCPYUR0019.mol |
| UTP | |
|---|---|
| |
| Structural Information | |
| Systematic Name | UTP |
| Common Name |
|
| Symbol | |
| Formula | C9H15N2O15P3 |
| Exact Mass | 483.9685 |
| Average Mass | 484.1411 |
| SMILES | O=C(C=2)NC(=O)N(C2)[C@H](O1)[C@H](O)[C@H](O)[C@@H] |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
- CTP ⇔ this
- [ [ [ [(2R,3S,4R,5R) -5- (2,4-Dioxopyrimidin-1-yl) -3,4-dihydroxyoxolan-2-yl] methoxy-hydroxyphosphoryl] oxy-hydroxyphosphoryl] oxy-hydroxyphosphoryl] [(2R,3S,4R,5R) -5- (2,4-dioxopyrimidin-1-yl) -3,4-dihydroxyoxolan-2-yl] methyl hydrogen phosphate ⇔ this
- this ⇔ [(2R,3S,5R) -5- (2,4-Dioxopyrimidin-1-yl) -3-hydroxyoxolan-2-yl] methyl [hydroxy(phosphonooxy) phosphoryl] hydrogen phosphate
- this ⇔ UDP
- this ⇔ UMP
- this ⇔ UDP-D-xylose
- this ⇔ UDP-D-galactose
- this ⇔ UDP-D-glucose
- this ⇔ (2S,3S,4S,5R,6R) -6- [ [ [ (2R,3S,4R,5R) -5- (2,4-dioxopyrimidin-1-yl) -3,4-dihydroxyoxolan-2-yl] methoxy-hydroxyphosphoryl] oxy-hydroxyphosphoryl] oxy-3,4,5-trihydroxyoxane-2-carboxylic acid
- this ⇔ UDP-N-acetyl-D-glucosamine
