FL1CUNNS0002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=2-[(2E)-1-Methoxy-3-phenyl-2-propenylidene]-4,5-dimethoxy-4-cyclopentene-1,3-dione | + | |SysName=2- [ (2E) -1-Methoxy-3-phenyl-2-propenylidene ] -4,5-dimethoxy-4-cyclopentene-1,3-dione |
| − | |Common Name=&&Methylliderone&&2-[(2E)-1-Methoxy-3-phenyl-2-propenylidene]-4,5-dimethoxy-4-cyclopentene-1,3-dione&& | + | |Common Name=&&Methylliderone&&2- [ (2E) -1-Methoxy-3-phenyl-2-propenylidene ] -4,5-dimethoxy-4-cyclopentene-1,3-dione&& |
|CAS=3984-73-4 | |CAS=3984-73-4 | ||
|KNApSAcK=C00007168 | |KNApSAcK=C00007168 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 3984-73-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CUNNS0002.mol |
| Methylliderone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- [ (2E) -1-Methoxy-3-phenyl-2-propenylidene ] -4,5-dimethoxy-4-cyclopentene-1,3-dione |
| Common Name |
|
| Symbol | |
| Formula | C17H16O5 |
| Exact Mass | 300.099773622 |
| Average Mass | 300.30593999999996 |
| SMILES | COC(C=Cc(c2)cccc2)=C(C(=O)1)C(=O)C(OC)=C(OC)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
