FL2FA9NI0002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=5-Hydroxy-7-(3-methyl-2,3-epoxybutoxy)flavanone | + | |SysName=5-Hydroxy-7- (3-methyl-2,3-epoxybutoxy) flavanone |
| − | |Common Name=&&5-Hydroxy-7-(3-methyl-2,3-epoxybutoxy)flavanone&& | + | |Common Name=&&5-Hydroxy-7- (3-methyl-2,3-epoxybutoxy) flavanone&& |
|CAS=94390-14-4 | |CAS=94390-14-4 | ||
|KNApSAcK=C00008163 | |KNApSAcK=C00008163 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 94390-14-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FA9NI0002.mol |
| 5-Hydroxy-7- (3-methyl-2,3-epoxybutoxy) flavanone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5-Hydroxy-7- (3-methyl-2,3-epoxybutoxy) flavanone |
| Common Name |
|
| Symbol | |
| Formula | C20H20O5 |
| Exact Mass | 340.13107375 |
| Average Mass | 340.3698 |
| SMILES | C(C1)(c(c4)cccc4)Oc(c2)c(c(cc(OCC(C(C)(C)3)O3)2)O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
