FL2FA9NM0014
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=(S)-5,7-Dimethoxy-6-(hydroxymethyl)-8-methylflavanone | + | |SysName= (S) -5,7-Dimethoxy-6- (hydroxymethyl) -8-methylflavanone |
− | |Common Name=&&5-O-Methylleridol&&(S)-5,7-Dimethoxy-6-(hydroxymethyl)-8-methylflavanone&& | + | |Common Name=&&5-O-Methylleridol&& (S) -5,7-Dimethoxy-6- (hydroxymethyl) -8-methylflavanone&& |
|CAS=143084-67-7 | |CAS=143084-67-7 | ||
|KNApSAcK=C00008483 | |KNApSAcK=C00008483 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 143084-67-7 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL2FA9NM0014.mol |
5-O-Methylleridol | |
---|---|
![]() | |
Structural Information | |
Systematic Name | (S) -5,7-Dimethoxy-6- (hydroxymethyl) -8-methylflavanone |
Common Name |
|
Symbol | |
Formula | C19H20O5 |
Exact Mass | 328.13107375 |
Average Mass | 328.3591 |
SMILES | O(C2c(c3)cccc3)c(c1C)c(C(=O)C2)c(c(c1OC)CO)OC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|