FL3F18NF0002
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=2-(2,5-Dimethoxyphenyl)-4H-furo[2,3-h]-1-benzopyran-4-one |
|Common Name=&&Millettocalyxin C&&2-(2,5-Dimethoxyphenyl)-4H-furo[2,3-h]-1-benzopyran-4-one&& | |Common Name=&&Millettocalyxin C&&2-(2,5-Dimethoxyphenyl)-4H-furo[2,3-h]-1-benzopyran-4-one&& | ||
|CAS=422308-57-4 | |CAS=422308-57-4 | ||
|KNApSAcK=C00013453 | |KNApSAcK=C00013453 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 422308-57-4 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL3F18NF0002.mol |
Millettocalyxin C | |
---|---|
![]() | |
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C19H14O5 |
Exact Mass | 322.084123558 |
Average Mass | 322.31146 |
SMILES | c(c(C(O4)=CC(c(c43)ccc(c32)occ2)=O)1)(OC)ccc(OC)c1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|