FL3F2CNS0001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=7-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-6-methoxy-4H-1-benzopyran-4-one | + | |SysName=7-Hydroxy-2- (3-hydroxy-4-methoxyphenyl) -6-methoxy-4H-1-benzopyran-4-one |
− | |Common Name=&&Abrectorin&&7-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-6-methoxy-4H-1-benzopyran-4-one&& | + | |Common Name=&&Abrectorin&&7-Hydroxy-2- (3-hydroxy-4-methoxyphenyl) -6-methoxy-4H-1-benzopyran-4-one&& |
|CAS=76575-03-6 | |CAS=76575-03-6 | ||
|KNApSAcK=C00003872 | |KNApSAcK=C00003872 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 76575-03-6 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL3F2CNS0001.mol |
Abrectorin | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 7-Hydroxy-2- (3-hydroxy-4-methoxyphenyl) -6-methoxy-4H-1-benzopyran-4-one |
Common Name |
|
Symbol | |
Formula | C17H14O6 |
Exact Mass | 314.07903818 |
Average Mass | 314.28945999999996 |
SMILES | COc(c3)c(O)cc(c3)C(=C1)Oc(c2)c(cc(OC)c(O)2)C(=O)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|