FL3FAANI0004
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=5,7-Dihydroxy-2-(4-hydroxyphenyl)-6-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one | + | |SysName=5,7-Dihydroxy-2- (4-hydroxyphenyl) -6- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one |
| − | |Common Name=&&6-Prenylapigenin&&5,7,4'-Trihydroxy-6-prenylflavone&&6-C-Prenylapigenin&&5,7-Dihydroxy-2-(4-hydroxyphenyl)-6-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one&& | + | |Common Name=&&6-Prenylapigenin&&5,7,4'-Trihydroxy-6-prenylflavone&&6-C-Prenylapigenin&&5,7-Dihydroxy-2- (4-hydroxyphenyl) -6- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one&& |
|CAS=68097-13-2 | |CAS=68097-13-2 | ||
|KNApSAcK=C00004089 | |KNApSAcK=C00004089 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 68097-13-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FAANI0004.mol |
| 6-Prenylapigenin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7-Dihydroxy-2- (4-hydroxyphenyl) -6- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C20H18O5 |
| Exact Mass | 338.115423686 |
| Average Mass | 338.35392 |
| SMILES | C(=O)(C=1)c(c3O)c(cc(c(CC=C(C)C)3)O)OC1c(c2)ccc(O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
