FL3FACGS0035
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=5,7,3',4'-Tetrahydroxyflavone 7-galactoside-4'-glucoside |
|Common Name=&&Luteolin 7-galactoside-4'-glucoside&& | |Common Name=&&Luteolin 7-galactoside-4'-glucoside&& | ||
|CAS=- | |CAS=- | ||
|KNApSAcK=C00004295 | |KNApSAcK=C00004295 | ||
}} | }} | ||
Revision as of 09:00, 13 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | - |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FACGS0035.mol |
| Luteolin 7-galactoside-4'-glucoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,3',4'-Tetrahydroxyflavone 7-galactoside-4'-glucoside |
| Common Name |
|
| Symbol | |
| Formula | C27H30O16 |
| Exact Mass | 610.153384912 |
| Average Mass | 610.5175 |
| SMILES | c(O)(c4)c(c(cc(OC(C(O)5)OC(CO)C(O)C5O)4)1)C(=O)C=C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
