FL3FAENS0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=Diosmetin | + | |SysName=Diosmetin |
|Common Name=&&Diosmetin&&5,7,3'-Trihydroxy-4'-methoxyflavone&&4'-Methylluteolin&& | |Common Name=&&Diosmetin&&5,7,3'-Trihydroxy-4'-methoxyflavone&&4'-Methylluteolin&& | ||
|CAS=520-34-3 | |CAS=520-34-3 | ||
|KNApSAcK=C00001036 | |KNApSAcK=C00001036 | ||
}} | }} | ||
Revision as of 09:00, 10 March 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 520-34-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FAENS0001.mol |
| Diosmetin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Diosmetin |
| Common Name |
|
| Symbol | |
| Formula | C16H12O6 |
| Exact Mass | 300.063388116 |
| Average Mass | 300.26288 |
| SMILES | COc(c3)c(O)cc(c3)C(=C1)Oc(c2)c(c(O)cc(O)2)C(=O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
