FL4DPTNS0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(6aR,12aR)-2,3,10-Trihydroxy-6,12-dioxabenz(a)anthracen-7(5H,6aH,12aH)-one | + | |SysName= (6aR,12aR) -2,3,10-Trihydroxy-6,12-dioxabenz (a) anthracen-7 (5H,6aH,12aH) -one |
| − | |Common Name=&&Peltogynone&&(6aR,12aR)-2,3,10-Trihydroxy-6,12-dioxabenz(a)anthracen-7(5H,6aH,12aH)-one&& | + | |Common Name=&&Peltogynone&& (6aR,12aR) -2,3,10-Trihydroxy-6,12-dioxabenz (a) anthracen-7 (5H,6aH,12aH) -one&& |
|CAS=38279-52-6 | |CAS=38279-52-6 | ||
|KNApSAcK=C00008601 | |KNApSAcK=C00008601 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 38279-52-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL4DPTNS0001.mol |
| Peltogynone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (6aR,12aR) -2,3,10-Trihydroxy-6,12-dioxabenz (a) anthracen-7 (5H,6aH,12aH) -one |
| Common Name |
|
| Symbol | |
| Formula | C16H12O6 |
| Exact Mass | 300.063388116 |
| Average Mass | 300.26288 |
| SMILES | Oc(c4)cc(O1)c(c4)C(=O)C(O3)C1c(c2)c(C3)cc(O)c(O)2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
