FL5FBGNS0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=3,7,3',4',5'-Pentahydroxy-5-methoxyflavone | |SysName=3,7,3',4',5'-Pentahydroxy-5-methoxyflavone | ||
| − | |Common Name=&&Myricetin 5-methyl ether&& | + | |Common Name=&&Myricetin 5-methyl ether&&3,7,3',4',5'-Pentahydroxy-5-methoxyflavone&& |
|CAS=19077-84-0 | |CAS=19077-84-0 | ||
|KNApSAcK=C00004760 | |KNApSAcK=C00004760 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 19077-84-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FBGNS0001.mol |
| Myricetin 5-methyl ether | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,7,3',4',5'-Pentahydroxy-5-methoxyflavone |
| Common Name |
|
| Symbol | |
| Formula | C16H12O8 |
| Exact Mass | 332.05321735999996 |
| Average Mass | 332.26168 |
| SMILES | COc(c3)c(C(=O)2)c(cc(O)3)OC(=C(O)2)c(c1)cc(O)c(O)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
