FL5FFANS0012
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=Herbacetin 3,7,8-trimethyl ether | + | |SysName=Herbacetin 3,7,8-trimethyl ether |
|Common Name=&&Herbacetin 3,7,8-trimethyl ether&&5,4'-Dihydroxy-3,7,8-trimethoxyflavone&&5-Hydroxy-2-(4-hydroxyphenyl)-3,7,8-trimethoxy-4H-1-benzopyran-4-one&& | |Common Name=&&Herbacetin 3,7,8-trimethyl ether&&5,4'-Dihydroxy-3,7,8-trimethoxyflavone&&5-Hydroxy-2-(4-hydroxyphenyl)-3,7,8-trimethoxy-4H-1-benzopyran-4-one&& | ||
|CAS=6586-29-4 | |CAS=6586-29-4 | ||
|KNApSAcK=C00004619 | |KNApSAcK=C00004619 | ||
}} | }} | ||
Revision as of 09:00, 10 March 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 6586-29-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FFANS0012.mol |
| Herbacetin 3,7,8-trimethyl ether | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Herbacetin 3,7,8-trimethyl ether |
| Common Name |
|
| Symbol | |
| Formula | C18H16O7 |
| Exact Mass | 344.089602866 |
| Average Mass | 344.31543999999997 |
| SMILES | c(c1OC)(OC)cc(c(C2=O)c(OC(c(c3)ccc(O)c3)=C2OC)1)O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
