FL63RNNS0002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=6,12-Methano-6H,12H-dibenzo[b,f][1,5]dioxocin-2,3,9,13-tetrol | |SysName=6,12-Methano-6H,12H-dibenzo[b,f][1,5]dioxocin-2,3,9,13-tetrol | ||
| − | |Common Name=&&6,12- | + | |Common Name=&&6,12-Methano-6H,12H-dibenzo[b,f][1,5]dioxocin-2,3,9,13-tetrol&& |
|CAS=119116-87-9 | |CAS=119116-87-9 | ||
|KNApSAcK=C00009002 | |KNApSAcK=C00009002 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 119116-87-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL63RNNS0002.mol |
| 6,12-Methano-6H,12H-dibenzo[b,f][1,5]dioxocin-2,3,9,13-tetrol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 6,12-Methano-6H,12H-dibenzo[b,f][1,5]dioxocin-2,3,9,13-tetrol |
| Common Name |
|
| Symbol | |
| Formula | C15H12O6 |
| Exact Mass | 288.063388116 |
| Average Mass | 288.25218 |
| SMILES | Oc(c4)cc(O1)c(c4)C(O2)C(O)C1c(c3)c(cc(O)c(O)3)2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
