LBF10000BC04
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA7141 | |LipidBank=DFA7141 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA7141 |
LipidMaps | LMFA01020173 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF10000BC04.mol |
![]() | |
Structural Information | |
Systematic Name | 2-Ethyl-2-Butyl Decanoic Acid |
Common Name | |
Symbol | |
Formula | C16H32O2 |
Exact Mass | 256.240230268 |
Average Mass | 256.42408 |
SMILES | CCCCCCCCC(CC)(CCCC)C(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | 138-139°C/0.4mmHg <<7123>> |
Density | |
Optical Rotation | h25/D=1.4500<<7123>> |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |