LBF10105BC01
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA7110 | |LipidBank=DFA7110 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA7110 |
| LipidMaps | LMFA01020142 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF10105BC01.mol |
| |
| Structural Information | |
| Systematic Name | 6-Isopentyl-9-Methyl-5-Decenoic Acid |
| Common Name | |
| Symbol | |
| Formula | C16H30O2 |
| Exact Mass | 254.22458020399998 |
| Average Mass | 254.4082 |
| SMILES | CC(C)CCC=C(CCCC(O)=O)CCC(C)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | 142 - 145°C/0.2mmHg <<7110>> |
| Density | |
| Optical Rotation | h20/D = 1.4562 <<7110>> |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
