LBF12203JA01
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA8101 | |LipidBank=DFA8101 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA8101 |
LipidMaps | - |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF12203JA01.mol |
Cucurbic acid | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 3-Hydroxy-2- (2-pentenyl) -cyclopentane 1-acetic acid |
Common Name |
|
Symbol | |
Formula | C12H20O3 |
Exact Mass | 212.141244506 |
Average Mass | 212.28539999999998 |
SMILES | CCC=CCC(C(O)1)C(CC1)CC(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |