LBF13111BC02
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA7077 | |LipidBank=DFA7077 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA7077 |
LipidMaps | LMFA01020109 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF13111BC02.mol |
![]() | |
Structural Information | |
Systematic Name | (E) 2,5-Dimethyl-2-Tridecenoic Acid |
Common Name | |
Symbol | |
Formula | C15H28O2 |
Exact Mass | 240.20893013999998 |
Average Mass | 240.38162 |
SMILES | CCCCCCCCC(C)CC=C(C)C(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | 182°C/3mmHg <<7024>> |
Density | |
Optical Rotation | h25/D: 1.4663 <<7024>> |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | lmax: 218.5nm, emax: 14870<<7024>> |
IR Spectra | |
NMR Spectra | |
Chromatograms |