LBF161nnPG02
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR1521 | |LipidBank=XPR1521 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR1521 |
LipidMaps | LMFA03010139 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF161nnPG02.mol |
PROSTAGLANDIN Falpha-MAJOR URINARY METABOLITE | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 8- [ 2 (R) - (2-Carboxyethyl) -3 (S) ,5 (R) -dihydroxycyclopentan-1 (R) -yl ] -6-oxooctanoic acid |
Common Name |
|
Symbol | |
Formula | C16H26O7 |
Exact Mass | 330.167853186 |
Average Mass | 330.37343999999996 |
SMILES | OC(=O)CCCCC(=O)CC[C@@H]([C@H](O)1)[C@@H](CCC(O)=O) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | DIMETHYL ESTER DI-TMS ETHER ; m/e 502(M+), 487, 412, 397, 325, 322, 291, 254, 241, 228, 217, 191, 179, 143 <<1062>> |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |