LBF17000OX01
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA0443 | |LipidBank=DFA0443 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA0443 |
LipidMaps | LMFA01060059 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF17000OX01.mol |
9-Ketoheptadecylic acid | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 9-Oxoheptadecanoic acid |
Common Name |
|
Symbol | |
Formula | C17H32O3 |
Exact Mass | 284.23514489 |
Average Mass | 284.43417999999997 |
SMILES | CCCCCCCCC(=O)CCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | 78.5°C |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | <<0318>><<0319>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |