LBF18000HO24
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA0357 | |LipidBank=DFA0357 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA0357 |
LipidMaps | LMFA01050091 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18000HO24.mol |
9,12-Dihydroxystearic acid | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 9,12-Dihydroxyoctadecanoic acid |
Common Name |
|
Symbol | |
Formula | C18H36O4 |
Exact Mass | 316.26135963999997 |
Average Mass | 316.47604 |
SMILES | CCCCCCC(O)CCC(O)CCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | 90°C |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | soluble in alcohol ; sparingly soluble in ethanol ; insoluble in petroleum and ethanol<<0200>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |