LBF18206SC08
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA0162 | |LipidBank=DFA0162 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0162 |
| LipidMaps | LMFA01030123 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18206SC08.mol |
| Linolelaidic | |
|---|---|
| |
| Structural Information | |
| Systematic Name | trans-9, trans-12-Octadecadienoic acid |
| Common Name |
|
| Symbol | |
| Formula | C18H32O2 |
| Exact Mass | 280.240230268 |
| Average Mass | 280.44548000000003 |
| SMILES | CCCCCC=CCC=CCCCCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | 28°C to 29°C |
| Boiling Point | 179°C to 183°C at 0.8mmHg |
| Density | |
| Optical Rotation | 1.4641 at 27°C |
| Reflactive Index | |
| Solubility | soluble in alcohol, ether, methyl alcohol and petroleum ether.<<0127>><<0193>><<0275>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
