LBF20406AM01
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7017 | |LipidBank=XPR7017 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR7017 |
LipidMaps | LMFA08020003 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM01.mol |
![]() | |
Structural Information | |
Systematic Name | N-arachidonoylglycine |
Common Name | |
Symbol | |
Formula | C22H35NO3 |
Exact Mass | 361.261693991 |
Average Mass | 361.51824 |
SMILES | C(CCCC=CCC=CCC=CCC=CCCCCC)(NCC(O)=O)=O |
Physicochemical Information | |
Melting Point | colorless oil <<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CDCl3) d6.25 (br s 1H), 5.30-5.37 (m, 8H), 4.05 (d, J=5.1Hz, 2H), 2.76-2.82 (m, 6H), 2.22 (t, J=7.8Hz, 2H), 2.04-2.18 (m, 2H), 1.70-1.82 (m, 4H), 1.25-1.35 (m, 6H), 0.89 (t, J=7.1Hz, 3H) <<7001>> |
Chromatograms |