LBF20406HO20
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR6101 | |LipidBank=XPR6101 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR6101 |
LipidMaps | - |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406HO20.mol |
![]() | |
Structural Information | |
Systematic Name | 5 (S) -Hydroxy-6,8,11,14- (E,Z,Z,Z) -eicosatetraenoic acid |
Common Name | |
Symbol | |
Formula | C20H32O3 |
Exact Mass | 320.23514489 |
Average Mass | 320.46628 |
SMILES | C(CC=CCC=CCC=CC=C[C@@H](CCCC(O)=O)O)CCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | METHYL ESTER ; [a]XD23=+14.0°(C=2.0, BENZENE) <<1079>> |
Solubility | DIETHYL ETHER <<1080>> |
Spectral Information | |
Mass Spectra | METHYL ESTER ETHER ; m/e 406(M+), 391, 375, 316, 305, 255, 216, 215, 203, 190, 155, 150, 143, 136, 105, 80, 79 <<1080>> |
UV Spectra | METHYL ESTER ; l MeOHmax = 235nm (e 30,500) <<1080>> |
IR Spectra | |
NMR Spectra | |
Chromatograms |