LBF22603SC01
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA0224 | |LipidBank=DFA0224 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0224 |
| LipidMaps | LMFA01030185 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF22603SC01.mol |
| Docosahexaenoic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | cis-4, cis-7, cis-10, cis-13, cis-16, cis-19-Docosahexaenoic acid |
| Common Name |
|
| Symbol | |
| Formula | C22H32O2 |
| Exact Mass | 328.240230268 |
| Average Mass | 328.48828000000003 |
| SMILES | C(CCC(O)=O)=CCC=CCC=CCC=CCC=CCC=CCC |
| Physicochemical Information | |
| Melting Point | -44.2 to -44.1 °C |
| Boiling Point | |
| Density | |
| Optical Rotation | 1.5017 at 26 °C |
| Reflactive Index | |
| Solubility | soluble in benzene, chloroform, methyl alcohol, ether and petroleum ether.<<0292>><<0294>><<0526>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | Gas liquid chromatogram  (provided by Dr. Akiko Horiuchi). |
