LBF24109SC02
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA0132 | |LipidBank=DFA0132 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0132 |
| LipidMaps | LMFA01030093 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF24109SC02.mol |
| trans-Selacholeic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | trans-15-Tetracosenoic acid |
| Common Name |
|
| Symbol | |
| Formula | C24H46O2 |
| Exact Mass | 366.349780716 |
| Average Mass | 366.62084 |
| SMILES | C(CCCCC(O)=O)CCCCCCCCC=CCCCCCCCC |
| Physicochemical Information | |
| Melting Point | 65.5°C |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | <<0092>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
