BMACIZAMm001
From Metabolomics.JP
(Difference between revisions)
m (BMAXCCIZm001 moved to BMACIZAMm001) |
Revision as of 13:01, 8 September 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 3650-73-5 |
KEGG | C00884 |
KNApSAcK | |
CDX file | |
MOL file | BMACIZAMm001.mol |
Homocarnosine | |
---|---|
![]() | |
Structural Information | |
Systematic Name | L-Homocarnosine |
Common Name |
|
Symbol | |
Formula | C10H16N4O3 |
Exact Mass | 240.1222 |
Average Mass | 240.2592 |
SMILES | NCCCC(=O)N[C@H](C(O)=O)Cc(c1)ncn1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways