BMCCBR--q001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(+)-cis-Sabinol | + | |SysName= (+) -cis-Sabinol |
| − | |Common Name=&&(+)-cis-Sabinol&& | + | |Common Name=&& (+) -cis-Sabinol&& |
|CAS=471-16-9 | |CAS=471-16-9 | ||
|KEGG=C02213 | |KEGG=C02213 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 471-16-9 |
| KEGG | C02213 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMCCBR--q001.mol |
| (+) -cis-Sabinol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (+) -cis-Sabinol |
| Common Name |
|
| Symbol | |
| Formula | C10H16O |
| Exact Mass | 152.1201 |
| Average Mass | 152.2334 |
| SMILES | CC(C)[C@](C2)(C1)[C@@H](C(=C)[C@H](O)2)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
