BMCCID--j027
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=Indole-pyruvic acid | |SysName=Indole-pyruvic acid | ||
| − | |Common Name=&&Indolepyruvate&&Indolepyruvic acid&&(Indol-3-yl)pyruvate&& | + | |Common Name=&&Indolepyruvate&&Indolepyruvic acid&& (Indol-3-yl) pyruvate&& |
|CAS=35656-49-6 | |CAS=35656-49-6 | ||
|KEGG=C00331 | |KEGG=C00331 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 35656-49-6 |
| KEGG | C00331 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMCCID--j027.mol |
| Indolepyruvate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Indole-pyruvic acid |
| Common Name |
|
| Symbol | |
| Formula | C11H9NO3 |
| Exact Mass | 203.0582 |
| Average Mass | 203.1941 |
| SMILES | OC(=O)C(=O)Cc(c1)c(c2)c(ccc2)n1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
