BMMCBZ2Ok003
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(S)-2-Hydroxy-2-phenyl-acetic acid | + | |SysName= (S) -2-Hydroxy-2-phenyl-acetic acid |
| − | |Common Name=&&(S)-Mandelate&&(S)-2-Hydroxy-2-phenylacetic acid&&(S)-2-Hydroxy-2-phenylacetate&& | + | |Common Name=&& (S) -Mandelate&& (S) -2-Hydroxy-2-phenylacetic acid&& (S) -2-Hydroxy-2-phenylacetate&& |
|CAS=17199-29-0 | |CAS=17199-29-0 | ||
|KEGG=C01984 | |KEGG=C01984 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 17199-29-0 |
| KEGG | C01984 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCBZ2Ok003.mol |
| (S) -Mandelate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (S) -2-Hydroxy-2-phenyl-acetic acid |
| Common Name |
|
| Symbol | |
| Formula | C8H8O3 |
| Exact Mass | 152.0473 |
| Average Mass | 152.1473 |
| SMILES | OC(=O)[C@@H](O)c(c1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
