BMMCBZ2Pd044
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=6-Oxo-2-hydroxy-7-(4'-chlorophenyl)-3,8,8,8-tetrachloroocta-2E,4E-dienoic acid | + | |SysName=6-Oxo-2-hydroxy-7- (4'-chlorophenyl) -3,8,8,8-tetrachloroocta-2E,4E-dienoic acid |
− | |Common Name=&&6-Oxo-2-hydroxy-7-(4'-chlorophenyl)-3,8,8,8-tetrachloroocta-2E,4E-&&dienoate&& | + | |Common Name=&&6-Oxo-2-hydroxy-7- (4'-chlorophenyl) -3,8,8,8-tetrachloroocta-2E,4E-&&dienoate&& |
|CAS=? | |CAS=? | ||
|KEGG=C06651 | |KEGG=C06651 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C06651 |
KNApSAcK | |
CDX file | |
MOL file | BMMCBZ2Pd044.mol |
6-Oxo-2-hydroxy-7- (4'-chlorophenyl) -3,8,8,8-tetrachloroocta-2E,4E- | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 6-Oxo-2-hydroxy-7- (4'-chlorophenyl) -3,8,8,8-tetrachloroocta-2E,4E-dienoic acid |
Common Name |
|
Symbol | |
Formula | C14H9Cl5O4 |
Exact Mass | 415.8943 |
Average Mass | 418.4823 |
SMILES | OC(=O)C(O)=C(Cl)C=CC(=O)C(c(c1)ccc(Cl)c1)C(Cl)(Cl) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |