FL1CA9NI0003
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 10 March 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 116107-09-6 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL1CA9NI0003.mol |
2',4'-Dihydroxy-6'-methoxy-3'-prenylchalcone | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 2',4'-Dihydroxy-6'-methoxy-3'-prenylchalcone |
Common Name |
|
Symbol | |
Formula | C21H22O4 |
Exact Mass | 338.151809192 |
Average Mass | 338.39698 |
SMILES | COc(c2)c(c(c(CC=C(C)C)c(O)2)O)C(=O)C=Cc(c1)cccc1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|