FL2FQUNS0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=(-)-2-(3,4-Dihydro-5-hydroxy-7-methoxy-4-oxo-2H-1-benzopyran-2-yl)-5-methoxy-2,5-cyclohexadiene-1,4-dione | |SysName=(-)-2-(3,4-Dihydro-5-hydroxy-7-methoxy-4-oxo-2H-1-benzopyran-2-yl)-5-methoxy-2,5-cyclohexadiene-1,4-dione | ||
| − | |Common Name=&&Remerin&& | + | |Common Name=&&Remerin&&(-)-2-(3,4-Dihydro-5-hydroxy-7-methoxy-4-oxo-2H-1-benzopyran-2-yl)-5-methoxy-2,5-cyclohexadiene-1,4-dione&& |
|CAS=41093-65-6 | |CAS=41093-65-6 | ||
|KNApSAcK=C00008365 | |KNApSAcK=C00008365 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 41093-65-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FQUNS0001.mol |
| Remerin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (-)-2-(3,4-Dihydro-5-hydroxy-7-methoxy-4-oxo-2H-1-benzopyran-2-yl)-5-methoxy-2,5-cyclohexadiene-1,4-dione |
| Common Name |
|
| Symbol | |
| Formula | C17H14O7 |
| Exact Mass | 330.073952802 |
| Average Mass | 330.28886 |
| SMILES | COc(c3)cc(O1)c(c(O)3)C(=O)CC1c(c2)c(=O)cc(OC)c(=O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
