FL3FF9NS0004
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=7-O-Methylwogonin | + | |SysName=7-O-Methylwogonin |
|Common Name=&&7-O-Methylwogonin&&7-O-Methylwogonine&&Moslosooflavone&&5-Hydroxy-7,8-dimethoxyflavone&& | |Common Name=&&7-O-Methylwogonin&&7-O-Methylwogonine&&Moslosooflavone&&5-Hydroxy-7,8-dimethoxyflavone&& | ||
|CAS=3570-62-5 | |CAS=3570-62-5 | ||
|KNApSAcK=C00003810 | |KNApSAcK=C00003810 | ||
}} | }} | ||
Revision as of 09:00, 10 March 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 3570-62-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FF9NS0004.mol |
| 7-O-Methylwogonin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7-O-Methylwogonin |
| Common Name |
|
| Symbol | |
| Formula | C17H14O5 |
| Exact Mass | 298.084123558 |
| Average Mass | 298.29006 |
| SMILES | COc(c3)c(OC)c(O1)c(c(O)3)C(=O)C=C(c(c2)cccc2)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
