FL4DACGS0013
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(2S,3R)-3,5,7,3',4'-Pentahydroxyflavanone 3-rhamnoside | + | |SysName= (2S,3R) -3,5,7,3',4'-Pentahydroxyflavanone 3-rhamnoside |
| − | |Common Name=&&Neoisoastilbin&&(2S,3R)-3,5,7,3',4'-Pentahydroxyflavanone 3-rhamnoside&& | + | |Common Name=&&Neoisoastilbin&& (2S,3R) -3,5,7,3',4'-Pentahydroxyflavanone 3-rhamnoside&& |
|CAS=54141-72-9 | |CAS=54141-72-9 | ||
|KNApSAcK=C00008705 | |KNApSAcK=C00008705 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 54141-72-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL4DACGS0013.mol |
| Neoisoastilbin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2S,3R) -3,5,7,3',4'-Pentahydroxyflavanone 3-rhamnoside |
| Common Name |
|
| Symbol | |
| Formula | C21H22O11 |
| Exact Mass | 450.116211546 |
| Average Mass | 450.39278 |
| SMILES | C(C(=O)3)(C(Oc(c4)c3c(cc(O)4)O)c(c2)cc(c(O)c2)O)OC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
