FL5FA9NS0002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=Galangin | + | |SysName=Galangin |
|Common Name=&&Galangin&& Norizalpinin&&3,5,7-Trihydroxyflavone&&3,5,7-Trihydroxy-2-phenyl-4H-1-benzopyran-4-one&& | |Common Name=&&Galangin&& Norizalpinin&&3,5,7-Trihydroxyflavone&&3,5,7-Trihydroxy-2-phenyl-4H-1-benzopyran-4-one&& | ||
|CAS=548-83-4 | |CAS=548-83-4 | ||
|KNApSAcK=C00004533 | |KNApSAcK=C00004533 | ||
}} | }} | ||
Revision as of 09:00, 10 March 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 548-83-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FA9NS0002.mol |
| Galangin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Galangin |
| Common Name |
|
| Symbol | |
| Formula | C15H10O5 |
| Exact Mass | 270.05282343 |
| Average Mass | 270.2369 |
| SMILES | Oc(c3)cc(O1)c(c(O)3)C(=O)C(O)=C1c(c2)cccc2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
