FL5FA9NS0005
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| Line 3: | Line 3: | ||
| {{Metabolite | {{Metabolite | ||
| |SysName=3,5-Dihydroxy-7-methoxy-2-phenyl-4H-1-benzopyran-4-one | |SysName=3,5-Dihydroxy-7-methoxy-2-phenyl-4H-1-benzopyran-4-one | ||
| − | |Common Name= | + | |Common Name=&&Izalpinin&&Isalpinin&&3,5-Dihydroxy-7-methoxyflavone&&7-O-Methylgalangin&&Galangin 7-methyl ether&& | 
| |CAS=480-14-8 | |CAS=480-14-8 | ||
| |KNApSAcK=C00004536 | |KNApSAcK=C00004536 | ||
| }} | }} | ||
Revision as of 14:51, 6 August 2012
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FA9 5,7,(3'),(5')-Hydroxyflavonol and O-methyl derivatives (30 pages) : FL5FA9NS Simple substitution (7 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 480-14-8 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FA9NS0005.mol | 
| Izalpinin | |
|---|---|
|   | |
| Structural Information | |
| Systematic Name | 3,5-Dihydroxy-7-methoxy-2-phenyl-4H-1-benzopyran-4-one | 
| Common Name | 
 | 
| Symbol | |
| Formula | C16H12O5 | 
| Exact Mass | 284.068473494 | 
| Average Mass | 284.26348 | 
| SMILES | COc(c3)cc(O1)c(c(O)3)C(=O)C(O)=C1c(c2)cccc2 | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
