FL5FAAGL0024
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|SysName=3,5,7,4'-Tetrahydroxyflavone 3-rhamnosyl- (1->2) -rhamnosyl- (1->6) -glucoside | |SysName=3,5,7,4'-Tetrahydroxyflavone 3-rhamnosyl- (1->2) -rhamnosyl- (1->6) -glucoside | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FAA Kaempferol (349 pages) : FL5FAAGL 3-Glucoside and related (112 pages) : FL5FAAGL0 Normal (109 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 32602-83-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FAAGL0024.mol |
| Kaempferol 3-rhamnosyl- (1->2) -rhamnosyl- (1->6) -glucoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,7,4'-Tetrahydroxyflavone 3-rhamnosyl- (1->2) -rhamnosyl- (1->6) -glucoside |
| Common Name |
|
| Symbol | |
| Formula | C33H40O19 |
| Exact Mass | 740.216379098 |
| Average Mass | 740.6593 |
| SMILES | OC(C(COC(O5)C(OC(C6O)OC(C(C6O)O)C)C(O)C(C(C)5)O)1) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
