FL5FCBNS0001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=Kaempferol 7,4'-dimethyl ether | + | |SysName=Kaempferol 7,4'-dimethyl ether |
|Common Name=&&Kaempferol 7,4'-dimethyl ether&&3,5-Dihydroxy-7,4'-dimethoxyflavone&&3,5-Dihydroxy-7-methoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one&& | |Common Name=&&Kaempferol 7,4'-dimethyl ether&&3,5-Dihydroxy-7,4'-dimethoxyflavone&&3,5-Dihydroxy-7-methoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one&& | ||
|CAS=15486-33-6 | |CAS=15486-33-6 | ||
|KNApSAcK=C00004571 | |KNApSAcK=C00004571 | ||
}} | }} |
Revision as of 09:00, 10 March 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 15486-33-6 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL5FCBNS0001.mol |
Kaempferol 7,4'-dimethyl ether | |
---|---|
![]() | |
Structural Information | |
Systematic Name | Kaempferol 7,4'-dimethyl ether |
Common Name |
|
Symbol | |
Formula | C17H14O6 |
Exact Mass | 314.07903818 |
Average Mass | 314.28945999999996 |
SMILES | COc(c3)ccc(c3)C(O1)=C(O)C(=O)c(c(O)2)c(cc(OC)c2)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |