FL5FCENSS002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=3,5,3'-Trihydroxy-7,4'-dimethoxyflavone 3,3'-di-O-sulfate |
|Common Name=&&Ombuin 3,3'-di-O-sulfate&& | |Common Name=&&Ombuin 3,3'-di-O-sulfate&& | ||
|CAS=79174-99-5 | |CAS=79174-99-5 | ||
|KNApSAcK=C00004976 | |KNApSAcK=C00004976 | ||
}} | }} | ||
Revision as of 09:00, 13 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 79174-99-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FCENSS002.mol |
| Ombuin 3,3'-di-O-sulfate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,3'-Trihydroxy-7,4'-dimethoxyflavone 3,3'-di-O-sulfate |
| Common Name |
|
| Symbol | |
| Formula | C17H14O13S2 |
| Exact Mass | 489.987581914 |
| Average Mass | 490.41726 |
| SMILES | COc(c3)cc(O1)c(c(O)3)C(=O)C(OS(O)(=O)=O)=C1c(c2)cc |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
