FL5FEGNS0010
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=5,6-Dihydroxy-2-(3-hydroxy-4,5-dimethoxyphenyl)-3,7-dimethoxy-4H-1-benzopyran-4-one | + | |SysName=5,6-Dihydroxy-2- (3-hydroxy-4,5-dimethoxyphenyl) -3,7-dimethoxy-4H-1-benzopyran-4-one |
| − | |Common Name=&&Apuleitrin&&5,6-Dihydroxy-2-(3-hydroxy-4,5-dimethoxyphenyl)-3,7-dimethoxy-4H-1-benzopyran-4-one&& | + | |Common Name=&&Apuleitrin&&5,6-Dihydroxy-2- (3-hydroxy-4,5-dimethoxyphenyl) -3,7-dimethoxy-4H-1-benzopyran-4-one&& |
|CAS=34211-16-0 | |CAS=34211-16-0 | ||
|KNApSAcK=C00004830 | |KNApSAcK=C00004830 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 34211-16-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FEGNS0010.mol |
| Apuleitrin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,6-Dihydroxy-2- (3-hydroxy-4,5-dimethoxyphenyl) -3,7-dimethoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C19H18O9 |
| Exact Mass | 390.095082174 |
| Average Mass | 390.34082 |
| SMILES | c(c(OC)1)(OC)cc(C(O2)=C(C(c(c3O)c2cc(c3O)OC)=O)OC) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
